EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O4 |
| Net Charge | 0 |
| Average Mass | 312.450 |
| Monoisotopic Mass | 312.23006 |
| SMILES | CCCCC/C=C\C=C\[C@@H](CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h6,8,11,14,17,21H,2-5,7,9-10,12-13,15-16H2,1H3,(H,19,20)/b8-6-,14-11+/t17-/m0/s1 |
| InChIKey | JGUNZIWGNMQSBM-WXUVIADPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9(R)-HPODE (CHEBI:63331) has functional parent (10E,12Z)-octadecadienoic acid (CHEBI:44526) |
| 9(R)-HPODE (CHEBI:63331) is a HPODE (CHEBI:36329) |
| 9(R)-HPODE (CHEBI:63331) is conjugate acid of 9(R)-HPODE(1−) (CHEBI:63323) |
| 9(R)-HPODE (CHEBI:63331) is enantiomer of 9(S)-HPODE (CHEBI:34498) |
| Incoming Relation(s) |
| 9(R)-HPODE(1−) (CHEBI:63323) is conjugate base of 9(R)-HPODE (CHEBI:63331) |
| 9(S)-HPODE (CHEBI:34498) is enantiomer of 9(R)-HPODE (CHEBI:63331) |
| IUPAC Name |
|---|
| (9R,10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoic acid |
| Synonyms | Source |
|---|---|
| (9R,10E,12Z)-9-hydroperoxy-10,12-octadecadienoic acid | ChEBI |
| 9(R)-HpODE | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18880808 | Reaxys |
| Citations |
|---|