EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O3 |
| Net Charge | 0 |
| Average Mass | 252.269 |
| Monoisotopic Mass | 252.07864 |
| SMILES | COc1cccc(-c2cc(=O)c3ccccc3o2)c1 |
| InChI | InChI=1S/C16H12O3/c1-18-12-6-4-5-11(9-12)16-10-14(17)13-7-2-3-8-15(13)19-16/h2-10H,1H3 |
| InChIKey | KIEVPIBIYKKJRJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Primula veris (ncbitaxon:170927) | leaf (BTO:0000713) | PubMed (15896373) | |
| Hypericum riparium (IPNI:428595-1) | bark (BTO:0001301) | PubMed (24930002) | Isolated from stem bark. |
| Pimelea decora (ncbitaxon:586301) | - | Article (Freeman, P.W., Murphy, S.T., Nemorin, J.E. and Taylor, W.C. (1981) The constituents of Australian Pimelea species. II. The isolation of unusual flavones from P. simplex and P. decora. Aust. J. Chem., 34(8), 1779-1784.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-methoxyflavone (CHEBI:63327) has role plant metabolite (CHEBI:76924) |
| 3'-methoxyflavone (CHEBI:63327) is a 3'-methoxyflavones (CHEBI:138730) |
| IUPAC Name |
|---|
| 2-(3-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-(3-methoxyphenyl)chromen-4-one | ChEBI |
| 3'-methoxyflavone | KEGG COMPOUND |
| Citations |
|---|