EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6329 - L-α-amino-γ-oxalylaminobutyric acid
| Formula | C6H10N2O5 |
| Net Charge | 0 |
| Average Mass | 190.155 |
| Monoisotopic Mass | 190.05897 |
| SMILES | N[C@@H](CCNC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10N2O5/c7-3(5(10)11)1-2-8-4(9)6(12)13/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m0/s1 |
| InChIKey | DSBZQNMJXKJWTO-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-α-amino-γ-oxalylaminobutyric acid (CHEBI:6329) has functional parent L-2,4-diaminobutyric acid (CHEBI:48950) |
| L-α-amino-γ-oxalylaminobutyric acid (CHEBI:6329) has functional parent oxalic acid (CHEBI:16995) |
| L-α-amino-γ-oxalylaminobutyric acid (CHEBI:6329) has role metabolite (CHEBI:25212) |
| L-α-amino-γ-oxalylaminobutyric acid (CHEBI:6329) is a monocarboxylic acid amide (CHEBI:29347) |
| L-α-amino-γ-oxalylaminobutyric acid (CHEBI:6329) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-[(carboxycarbonyl)amino]butanoic acid |