EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N2O8 |
| Net Charge | 0 |
| Average Mass | 334.325 |
| Monoisotopic Mass | 334.13762 |
| SMILES | [H][C@@]1([C@@H](NC(C)=O)[C@H](C)O)O[C@](O)(C(=O)O)C[C@H](O)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C13H22N2O8/c1-5(16)9(14-6(2)17)11-10(15-7(3)18)8(19)4-13(22,23-11)12(20)21/h5,8-11,16,19,22H,4H2,1-3H3,(H,14,17)(H,15,18)(H,20,21)/t5-,8-,9-,10-,11-,13-/m0/s1 |
| InChIKey | ZJOSXOOPEBJBMC-LJRWBPDUSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudaminic acid (CHEBI:63281) is a ketoaldonic acid derivative (CHEBI:63394) |
| pseudaminic acid (CHEBI:63281) is conjugate acid of pseudaminate (CHEBI:63282) |
| Incoming Relation(s) |
| CMP-pseudaminic acid (CHEBI:63778) has functional parent pseudaminic acid (CHEBI:63281) |
| pseudaminate (CHEBI:63282) is conjugate base of pseudaminic acid (CHEBI:63281) |
| IUPAC Name |
|---|
| 5,7-diacetamido-3,5,7,9-tetradeoxy-L-glycero-α-L-manno-non-2-ulopyranosonic acid |
| Synonyms | Source |
|---|---|
| 5,7-Bis(acetylamino)-3,5,7,9-tetradeoxy-L-glycero-alpha-L-manno-2-nonulopyranosonic acid | KEGG COMPOUND |
| 5,7-bis(acetylamino)-3,5,7,9-tetradeoxy-L-glycero-α-L-manno-non-2-ulopyranosonic acid | IUPAC |
| Pse | ChEBI |
| Citations |
|---|