EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30N3O14P2 |
| Net Charge | -1 |
| Average Mass | 574.393 |
| Monoisotopic Mass | 574.12085 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])O[C@H]3O[C@H](C)[C@@H](O)[C@H]([NH+](C)C)[C@H]3O)O2)c(=O)nc1=O |
| InChI | InChI=1S/C18H31N3O14P2/c1-8-6-21(18(26)19-16(8)25)12-5-10(22)11(33-12)7-31-36(27,28)35-37(29,30)34-17-15(24)13(20(3)4)14(23)9(2)32-17/h6,9-15,17,22-24H,5,7H2,1-4H3,(H,27,28)(H,29,30)(H,19,25,26)/p-1/t9-,10+,11-,12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | IJJNPDQFXCRKOA-WHRNYZGVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-α-D-mycaminose(1−) (CHEBI:63268) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| dTDP-α-D-mycaminose(1−) (CHEBI:63268) is conjugate base of dTDP-α-D-mycaminose (CHEBI:29728) |
| Incoming Relation(s) |
| dTDP-α-D-mycaminose (CHEBI:29728) is conjugate acid of dTDP-α-D-mycaminose(1−) (CHEBI:63268) |
| Synonyms | Source |
|---|---|
| dTDP-3-dimethylamino-3,6-dideoxy-α-D-glucopyranose(1−) | ChEBI |
| dTDP-3-dimethylamino-3,6-dideoxy-α-D-glucopyranose anion | ChEBI |
| dTDP-3-dimethylamino-3,6-dideoxy-α-D-glucose(1−) | ChEBI |
| dTDP-3-dimethylamino-3,6-dideoxy-α-D-glucose anion | ChEBI |
| dTDP-α-D-mycaminose anion | ChEBI |
| thymidine 5'-{3-[3,6-dideoxy-3-(dimethylazaniumyl)-α-D-glucopyranosyl] diphosphate} | ChEBI |
| UniProt Name | Source |
|---|---|
| dTDP-α-D-mycaminose | UniProt |