EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H4F2O5 |
| Net Charge | 0 |
| Average Mass | 242.133 |
| Monoisotopic Mass | 242.00268 |
| SMILES | O=C(O)c1cc2cc(F)c(O)c(F)c2oc1=O |
| InChI | InChI=1S/C10H4F2O5/c11-5-2-3-1-4(9(14)15)10(16)17-8(3)6(12)7(5)13/h1-2,13H,(H,14,15) |
| InChIKey | VYNDHICBIRRPFP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pacific blue (CHEBI:63236) has role fluorochrome (CHEBI:51217) |
| pacific blue (CHEBI:63236) is a hydroxycoumarin (CHEBI:37912) |
| pacific blue (CHEBI:63236) is a monocarboxylic acid (CHEBI:25384) |
| pacific blue (CHEBI:63236) is a organofluorine compound (CHEBI:37143) |
| Incoming Relation(s) |
| pacific blue succinimidyl ester (CHEBI:63240) has functional parent pacific blue (CHEBI:63236) |
| IUPAC Name |
|---|
| 6,8-difluoro-7-hydroxy-2-oxo-2H-chromene-3-carboxylic acid |
| Synonym | Source |
|---|---|
| 6,8-difluoro-7-hydroxy-3-carboxycoumarin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8067623 | Reaxys |
| Citations |
|---|