EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO6 |
| Net Charge | 0 |
| Average Mass | 285.296 |
| Monoisotopic Mass | 285.12124 |
| SMILES | O=C(O)CCCCCC(=O)CC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C13H19NO6/c15-9(4-2-1-3-5-12(17)18)8-11(16)14-10-6-7-20-13(10)19/h10H,1-8H2,(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | VCDYSQBTCXVLFR-JTQLQIEISA-N |
| Roles Classification |
|---|
| Biological Role: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(8-carboxy-3-oxooctanoyl)-L-homoserine lactone (CHEBI:63226) is a N-acyl-L-homoserine lactone (CHEBI:55474) |
| N-(8-carboxy-3-oxooctanoyl)-L-homoserine lactone (CHEBI:63226) is a dicarboxylic acid monoamide (CHEBI:35735) |
| IUPAC Name |
|---|
| 7,9-dioxo-9-{[(3S)-2-oxotetrahydrofuran-3-yl]amino}nonanoic acid |
| Citations |
|---|