EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O4 |
| Net Charge | 0 |
| Average Mass | 312.450 |
| Monoisotopic Mass | 312.23006 |
| SMILES | CCCCC/C=C\C/C=C\[C@H](O)CC[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C18H32O4/c1-2-3-4-5-6-7-8-9-11-16(19)14-15-17(20)12-10-13-18(21)22/h6-7,9,11,16-17,19-20H,2-5,8,10,12-15H2,1H3,(H,21,22)/b7-6-,11-9-/t16-,17-/m0/s1 |
| InChIKey | CVXOCQUHJDKXHR-JFKQHRMJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(S),8(R)-DiHODE (CHEBI:63216) has functional parent linoleic acid (CHEBI:17351) |
| 5(S),8(R)-DiHODE (CHEBI:63216) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 5(S),8(R)-DiHODE (CHEBI:63216) is a octadecanoid (CHEBI:36326) |
| 5(S),8(R)-DiHODE (CHEBI:63216) is conjugate acid of 5(S),8(R)-DiHODE(1−) (CHEBI:63217) |
| Incoming Relation(s) |
| 5(S),8(R)-DiHODE(1−) (CHEBI:63217) is conjugate base of 5(S),8(R)-DiHODE (CHEBI:63216) |
| IUPAC Name |
|---|
| (5S,8R,9Z,12Z)-5,8-dihydroxyoctadeca-9,12-dienoic acid |
| Synonym | Source |
|---|---|
| (5S,8R)-5,8-dihydroxylinoleic acid | ChEBI |
| Citations |
|---|