EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClN3O2 |
| Net Charge | 0 |
| Average Mass | 227.651 |
| Monoisotopic Mass | 227.04615 |
| SMILES | COC(=O)c1nc(C2CC2)nc(N)c1Cl |
| InChI | InChI=1S/C9H10ClN3O2/c1-15-9(14)6-5(10)7(11)13-8(12-6)4-2-3-4/h4H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | MDWRNPOBHVLALB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminocyclopyrachlor-methyl (CHEBI:63215) has functional parent aminocyclopyrachlor (CHEBI:62952) |
| aminocyclopyrachlor-methyl (CHEBI:63215) has role herbicide (CHEBI:24527) |
| aminocyclopyrachlor-methyl (CHEBI:63215) has role synthetic auxin (CHEBI:26841) |
| aminocyclopyrachlor-methyl (CHEBI:63215) is a methyl ester (CHEBI:25248) |
| aminocyclopyrachlor-methyl (CHEBI:63215) is a organochlorine pesticide (CHEBI:38656) |
| aminocyclopyrachlor-methyl (CHEBI:63215) is a primary amino compound (CHEBI:50994) |
| aminocyclopyrachlor-methyl (CHEBI:63215) is a pyrimidinecarboxylate ester (CHEBI:48451) |
| IUPAC Name |
|---|
| methyl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
| Synonyms | Source |
|---|---|
| 4-amino-5-chloro-2-cyclopropyl-6-methoxycarbonylpyrimidine | ChEBI |
| aminocyclopyrachlor methyl | ChEBI |
| aminocyclopyrachlor methyl ester | IUPAC |
| DPX-KJM44 | ChEBI |
| methyl 6-amino-5-chloro-2-cyclopropyl-4-pyrimidinecarboxylate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11329724 | Reaxys |
| CAS:858954-83-3 | ChemIDplus |
| Citations |
|---|