EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63214 - cefodizime
| Formula | C20H20N6O7S4 |
| Net Charge | 0 |
| Average Mass | 584.683 |
| Monoisotopic Mass | 584.02763 |
| SMILES | [H][C@]12SCC(CSc3nc(C)c(CC(=O)O)s3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C20H20N6O7S4/c1-7-10(3-11(27)28)37-20(22-7)36-5-8-4-34-17-13(16(30)26(17)14(8)18(31)32)24-15(29)12(25-33-2)9-6-35-19(21)23-9/h6,13,17H,3-5H2,1-2H3,(H2,21,23)(H,24,29)(H,27,28)(H,31,32)/b25-12-/t13-,17-/m1/s1 |
| InChIKey | XDZKBRJLTGRPSS-BGZQYGJUSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefodizime (CHEBI:63214) has role antibacterial drug (CHEBI:36047) |
| cefodizime (CHEBI:63214) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| cefodizime (CHEBI:63214) is a 1,3-thiazoles (CHEBI:38418) |
| cefodizime (CHEBI:63214) is a cephalosporin (CHEBI:23066) |
| cefodizime (CHEBI:63214) is a oxime O-ether (CHEBI:36816) |
| IUPAC Name |
|---|
| 7-{[(22Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-({[5-(carboxymethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl}methyl)-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefodizime | KEGG DRUG |
| cefodizimum | ChemIDplus |
| cefodizima | ChemIDplus |
| Synonyms | Source |
|---|---|
| CDZM | KEGG DRUG |
| (6R,7R)-7-{[(22Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-({[5-(carboxymethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl}methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5789079 | Reaxys |
| CAS:69739-16-8 | ChemIDplus |
| Citations |
|---|