EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15O6P |
| Net Charge | 0 |
| Average Mass | 250.187 |
| Monoisotopic Mass | 250.06062 |
| SMILES | O=C(O)CCP(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C9H15O6P/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | PZBFGYYEXUXCOF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| TCEP (CHEBI:63213) has role reducing agent (CHEBI:63247) |
| TCEP (CHEBI:63213) is a phosphine derivative (CHEBI:63258) |
| TCEP (CHEBI:63213) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Name |
|---|
| 3,3',3"-phosphanetriyltripropanoic acid |
| Synonyms | Source |
|---|---|
| tris(2-carboxyethyl)phosphine | SUBMITTER |
| 3,3',3''-phosphinidynetrispropanoic acid | ChEBI |