EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 507.182 |
| Monoisotopic Mass | 506.99575 |
| SMILES | Nc1nc(=O)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-7-9(14-10(17)13-8)15(3-12-7)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
| InChIKey | UOACBPRDWRDEHJ-KVQBGUIXSA-N |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-dATP (CHEBI:63208) is a purine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37042) |
| 2-hydroxy-dATP (CHEBI:63208) is conjugate acid of 2-hydroxy-dATP(3−) (CHEBI:63209) |
| Incoming Relation(s) |
| 2-hydroxy-dATP(3−) (CHEBI:63209) is conjugate base of 2-hydroxy-dATP (CHEBI:63208) |
| IUPAC Name |
|---|
| 2'-deoxy-2-oxo-3-hydroadenosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-2-hydroxyadenosine 5'-(tetrahydrogen triphosphate) | IUPAC |
| 2'-deoxy-2-hydroxyadenosine triphosphate | ChEBI |
| 2'-deoxyisoguanosine triphosphate | ChEBI |
| 2-HO-dATP | ChEBI |
| 2-OH-dATP | ChEBI |
| d(isoGTP) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8372094 | Reaxys |
| Reaxys:9455763 | Reaxys |
| Citations |
|---|