EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N6O12 |
| Net Charge | 0 |
| Average Mass | 536.410 |
| Monoisotopic Mass | 536.11392 |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1NCCCCCCNc1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N6O12/c27-19(28)13-7-11(23(31)32)9-15(25(35)36)17(13)21-5-3-1-2-4-6-22-18-14(20(29)30)8-12(24(33)34)10-16(18)26(37)38/h7-10,21-22H,1-6H2,(H,27,28)(H,29,30) |
| InChIKey | OKONRXVXCMMCHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1,N6-bis-DNCP-1,6-hexanediamine (CHEBI:63123) has functional parent hexane-1,6-diamine (CHEBI:39618) |
| N1,N6-bis-DNCP-1,6-hexanediamine (CHEBI:63123) is a C-nitro compound (CHEBI:35716) |
| N1,N6-bis-DNCP-1,6-hexanediamine (CHEBI:63123) is a N-substituted diamine (CHEBI:50441) |
| N1,N6-bis-DNCP-1,6-hexanediamine (CHEBI:63123) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2,2'-(hexane-1,6-diyldiimino)bis(3,5-dinitrobenzoic acid) |
| Synonyms | Source |
|---|---|
| N1,N6-bis-(2-carboxy-4,6-dinitrophenyl)-1,6-hexanediamine | ChEBI |
| N1,N6-bis-DNCP-hexane-1,6-diamine | ChEBI |
| N1,N6-bis-(2-carboxy-4,6-dinitrophenyl)hexane-1,6-diamine | ChEBI |
| Citations |
|---|