EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N4O12 |
| Net Charge | 0 |
| Average Mass | 502.433 |
| Monoisotopic Mass | 502.15472 |
| SMILES | O=C(CCCCCNc1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-])N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C19H26N4O12/c24-8-12-16(26)17(27)15(19(30)35-12)21-13(25)4-2-1-3-5-20-14-10(18(28)29)6-9(22(31)32)7-11(14)23(33)34/h6-7,12,15-17,19-20,24,26-27,30H,1-5,8H2,(H,21,25)(H,28,29)/t12-,15-,16-,17-,19-/m1/s1 |
| InChIKey | ACEVZSZSKUVYND-QLXPXKAKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[6-(DNCP-amino)hexanoyl]-β-D-glucosamine (CHEBI:63119) is a C-nitro compound (CHEBI:35716) |
| N-[6-(DNCP-amino)hexanoyl]-β-D-glucosamine (CHEBI:63119) is a N-acyl-β-D-glucosamine (CHEBI:63121) |
| N-[6-(DNCP-amino)hexanoyl]-β-D-glucosamine (CHEBI:63119) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 2-({6-[(2-carboxy-4,6-dinitrophenyl)amino]hexanoyl}amino)-2-deoxy-β-D-glucopyranose |
| Citations |
|---|