EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13O9P |
| Net Charge | 0 |
| Average Mass | 260.135 |
| Monoisotopic Mass | 260.02972 |
| SMILES | O=P(O)(O)OC[C@@H]1OC(O)(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4+,5+,6?/m0/s1 |
| InChIKey | BGWGXPAPYGQALX-JMSAOHGTSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-tagatofuranose 6-phosphate (CHEBI:6307) is a L-tagatose 6-phosphate (CHEBI:13173) |
| L-tagatofuranose 6-phosphate (CHEBI:6307) is conjugate acid of L-tagatofuranose 6-phosphate(2−) (CHEBI:58926) |
| Incoming Relation(s) |
| L-tagatofuranose 6-phosphate(2−) (CHEBI:58926) is conjugate base of L-tagatofuranose 6-phosphate (CHEBI:6307) |
| IUPAC Names |
|---|
| 6-O-phosphono-L-tagatofuranose |
| L-tagatofuranose 6-(dihydrogen phosphate) |
| Synonym | Source |
|---|---|
| L-Tagatose 6-phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06312 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:136598-66-8 | KEGG COMPOUND |