EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N5O |
| Net Charge | 0 |
| Average Mass | 277.372 |
| Monoisotopic Mass | 277.19026 |
| SMILES | CCCCCC[C@H]([C@H](C)O)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17)/t10-,11+/m0/s1 |
| InChIKey | IOSAAWHGJUZBOG-WDEREUQCSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). EC 3.5.4.4 (adenosine deaminase) inhibitor An EC 3.5.4.* (non-peptide cyclic amidine C-N hydrolase) inhibitor that interferes with the action of adenosine deaminase (EC 3.5.4.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-EHNA (CHEBI:63059) is a EHNA (CHEBI:63057) |
| (2S,3R)-EHNA (CHEBI:63059) is enantiomer of (2R,3S)-EHNA (CHEBI:63058) |
| Incoming Relation(s) |
| (2R,3S)-EHNA (CHEBI:63058) is enantiomer of (2S,3R)-EHNA (CHEBI:63059) |
| IUPAC Name |
|---|
| (2S,3R)-3-(6-amino-9H-purin-9-yl)nonan-2-ol |
| Synonym | Source |
|---|---|
| (S,R)-6-amino-β-hexyl-α-methyl-9H-purine-9-ethanol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| EH9 | PDBeChem |
| Citations |
|---|