EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32N6O2 |
| Net Charge | 0 |
| Average Mass | 520.637 |
| Monoisotopic Mass | 520.25867 |
| SMILES | c1ccc2c(Oc3nc(Nc4ccc(N5CCOCC5)cc4)c4ncn(C5CCCCC5)c4n3)cccc2c1 |
| InChI | InChI=1S/C31H32N6O2/c1-2-9-25(10-3-1)37-21-32-28-29(33-23-13-15-24(16-14-23)36-17-19-38-20-18-36)34-31(35-30(28)37)39-27-12-6-8-22-7-4-5-11-26(22)27/h4-8,11-16,21,25H,1-3,9-10,17-20H2,(H,33,34,35) |
| InChIKey | FYBHCRQFSFYWPY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | SMO receptor agonist An agonist that enhances the action of smoothened (SMO) receptor. osteogenesis regulator Any compound that induces or regulates osteogenesis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| purmorphamine (CHEBI:63053) has parent hydride 9H-purine (CHEBI:35589) |
| purmorphamine (CHEBI:63053) has role osteogenesis regulator (CHEBI:63054) |
| purmorphamine (CHEBI:63053) has role SMO receptor agonist (CHEBI:131809) |
| purmorphamine (CHEBI:63053) is a aromatic ether (CHEBI:35618) |
| purmorphamine (CHEBI:63053) is a morpholines (CHEBI:38785) |
| purmorphamine (CHEBI:63053) is a purines (CHEBI:26401) |
| purmorphamine (CHEBI:63053) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 9-cyclohexyl-N-[4-(morpholin-4-yl)phenyl]-2-(naphthalen-1-yloxy)-9H-purin-6-amine |
| Manual Xrefs | Databases |
|---|---|
| LSM-3649 | LINCS |
| Purmorphamine | Wikipedia |
| US2004157864 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10500685 | Reaxys |
| CAS:483367-10-8 | ChemIDplus |
| Citations |
|---|