EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O6.K.Na |
| Net Charge | 0 |
| Average Mass | 210.158 |
| Monoisotopic Mass | 209.95426 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].[K+].[Na+] |
| InChI | InChI=1S/C4H6O6.K.Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
| InChIKey | LJCNRYVRMXRIQR-OLXYHTOASA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potassium sodium L-tartrate (CHEBI:63019) has part L-tartrate(2−) (CHEBI:30924) |
| potassium sodium L-tartrate (CHEBI:63019) has role laxative (CHEBI:50503) |
| potassium sodium L-tartrate (CHEBI:63019) is a organic sodium salt (CHEBI:38700) |
| potassium sodium L-tartrate (CHEBI:63019) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium sodium (2R,3R)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| 2,3-Dihydroxybutanedioic acid, monopotassium monosodium salt | ChemIDplus |
| Monopotassium monosodium tartrate | ChemIDplus |
| Rochelle salt | ChemIDplus |
| ROCHELLE SALTS | SUBMITTER |
| Seignette salt | ChemIDplus |
| Sodium potassium L-tartrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Potassium_sodium_tartrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5789357 | Reaxys |
| CAS:304-59-6 | ChemIDplus |