EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:63017 - sodium L-tartrate
| Formula | C4H4O6.2Na |
| Net Charge | 0 |
| Average Mass | 194.050 |
| Monoisotopic Mass | 193.98033 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O6.2Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
| InChIKey | HELHAJAZNSDZJO-OLXYHTOASA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| Biological Role: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| Applications: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium L-tartrate (CHEBI:63017) has part L-tartrate(2−) (CHEBI:30924) |
| sodium L-tartrate (CHEBI:63017) has role food emulsifier (CHEBI:63047) |
| sodium L-tartrate (CHEBI:63017) has role laxative (CHEBI:50503) |
| sodium L-tartrate (CHEBI:63017) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium (2R,3R)-2,3-dihydroxybutanedioate |
| Synonyms | Source |
|---|---|
| Bisodium tartrate | ChemIDplus |
| disodium (R-(R*,R*))-2,3-dihydroxybutanedioate | ChemIDplus |
| Disodium L-(+)-tartrate | ChemIDplus |
| Disodium salt of L-(+)-tartaric acid | ChemIDplus |
| disodium tartrate | SUBMITTER |
| E-335(II) | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| CN101643409 | Patent |
| Sodium_tartrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5319817 | Reaxys |
| CAS:868-18-8 | ChemIDplus |