EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:62984 - zinc acetate
| Formula | 2C2H3O2.Zn |
| Net Charge | 0 |
| Average Mass | 183.478 |
| Monoisotopic Mass | 181.95575 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C2H4O2.Zn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | DJWUNCQRNNEAKC-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zinc acetate (CHEBI:62984) has role anti-inflammatory agent (CHEBI:67079) |
| zinc acetate (CHEBI:62984) has role antimicrobial agent (CHEBI:33281) |
| zinc acetate (CHEBI:62984) has role antitussive (CHEBI:51177) |
| zinc acetate (CHEBI:62984) has role antiviral agent (CHEBI:22587) |
| zinc acetate (CHEBI:62984) has role astringent (CHEBI:74783) |
| zinc acetate (CHEBI:62984) is a acetate salt (CHEBI:59230) |
| zinc acetate (CHEBI:62984) is a zinc molecular entity (CHEBI:27364) |
| IUPAC Name |
|---|
| zinc diacetate |
| Synonyms | Source |
|---|---|
| Acetic acid, zinc(II) salt | ChemIDplus |
| acetic acid, zinc salt | SUBMITTER |
| Acetic acid, zinc salt (2:1) | ChemIDplus |
| Anhydrous zinc acetate | ChEMBL |
| Dicarbomethoxyzinc | ChemIDplus |
| E650 | ChEMBL |
| Brand Names | Source |
|---|---|
| Zinc acetate anhydrous component of nano-dtpa capsule zinc acetate | ChEMBL |
| Zinc acetate anhydrous component of nanodtpa zinc acetate | ChEMBL |
| Zinc acetate anhydrous component of nanodtpa zn-dtpa zinc acetate | ChEMBL |
| Citations |
|---|