EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H4Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 207.016 |
| Monoisotopic Mass | 205.96498 |
| SMILES | Nc1cc(Cl)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) |
| InChIKey | NIXXQNOQHKNPEJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | herbicide A substance used to destroy plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminopyralid (CHEBI:62962) has functional parent picolinic acid (CHEBI:28747) |
| aminopyralid (CHEBI:62962) has role herbicide (CHEBI:24527) |
| aminopyralid (CHEBI:62962) is a aromatic amine (CHEBI:33860) |
| aminopyralid (CHEBI:62962) is a organochlorine pesticide (CHEBI:38656) |
| aminopyralid (CHEBI:62962) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 4-amino-3,6-dichloropyridine-2-carboxylic acid |
| Synonym | Source |
|---|---|
| 4-Amino-3,6-dichloro-2-pyridinecarboxylic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Aminopyralid | Wikipedia |
| 29 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11403922 | Reaxys |
| CAS:150114-71-9 | ChemIDplus |
| Citations |
|---|