EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H3O2.H4N |
| Net Charge | 0 |
| Average Mass | 77.083 |
| Monoisotopic Mass | 77.04768 |
| SMILES | CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 |
| InChIKey | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. |
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium acetate (CHEBI:62947) has role buffer (CHEBI:35225) |
| ammonium acetate (CHEBI:62947) has role food acidity regulator (CHEBI:64049) |
| ammonium acetate (CHEBI:62947) is a acetate salt (CHEBI:59230) |
| ammonium acetate (CHEBI:62947) is a ammonium salt (CHEBI:47704) |
| IUPAC Name |
|---|
| ammonium acetate |
| Synonyms | Source |
|---|---|
| acetic acid, ammonium salt | ChemIDplus |
| AcONH4 | ChEBI |
| ammonium ethanoate | ChEBI |
| azanium acetate | IUPAC |
| CH3COONH4 | ChEBI |
| CH3CO2NH4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 32 | PPDB |
| Ammonium_acetate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10774525 | Reaxys |
| Reaxys:3564799 | Reaxys |
| CAS:631-61-8 | ChemIDplus |
| Citations |
|---|