EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:62947 - ammonium acetate
| Formula | C2H3O2.H4N |
| Net Charge | 0 |
| Average Mass | 77.083 |
| Monoisotopic Mass | 77.04768 |
| SMILES | CC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C2H4O2.H3N/c1-2(3)4;/h1H3,(H,3,4);1H3 |
| InChIKey | USFZMSVCRYTOJT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. buffer Any substance or mixture of substances that, in solution (typically aqueous), resists change in pH upon addition of small amounts of acid or base. |
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium acetate (CHEBI:62947) has role buffer (CHEBI:35225) |
| ammonium acetate (CHEBI:62947) has role food acidity regulator (CHEBI:64049) |
| ammonium acetate (CHEBI:62947) is a acetate salt (CHEBI:59230) |
| ammonium acetate (CHEBI:62947) is a ammonium salt (CHEBI:47704) |
| IUPAC Name |
|---|
| ammonium acetate |
| Synonyms | Source |
|---|---|
| acetic acid, ammonium salt | ChemIDplus |
| AcONH4 | ChEBI |
| ammonium ethanoate | ChEBI |
| azanium acetate | IUPAC |
| CH3COONH4 | ChEBI |
| CH3CO2NH4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 32 | PPDB |
| Ammonium_acetate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10774525 | Reaxys |
| Reaxys:3564799 | Reaxys |
| CAS:631-61-8 | ChemIDplus |
| Citations |
|---|