EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:62935 - dehydroepiandrosterone 7-O-(carboxymethyl)oxime
| Formula | C21H29NO5 |
| Net Charge | 0 |
| Average Mass | 375.465 |
| Monoisotopic Mass | 375.20457 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])C(=NOCC(=O)O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C21H29NO5/c1-20-7-5-13(23)9-12(20)10-16(22-27-11-18(25)26)19-14-3-4-17(24)21(14,2)8-6-15(19)20/h10,13-15,19,23H,3-9,11H2,1-2H3,(H,25,26)/t13-,14-,15-,19-,20-,21-/m0/s1 |
| InChIKey | ZVQQBKJJJZODIH-XDLUYZMFSA-N |
| Roles Classification |
|---|
| Biological Role: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| Application: | immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroepiandrosterone 7-O-(carboxymethyl)oxime (CHEBI:62935) has functional parent dehydroepiandrosterone (CHEBI:28689) |
| dehydroepiandrosterone 7-O-(carboxymethyl)oxime (CHEBI:62935) has role immunological adjuvant (CHEBI:50847) |
| dehydroepiandrosterone 7-O-(carboxymethyl)oxime (CHEBI:62935) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| dehydroepiandrosterone 7-O-(carboxymethyl)oxime (CHEBI:62935) is a ketoxime (CHEBI:24983) |
| IUPAC Name |
|---|
| ({[(3β)-3-hydroxy-17-oxoandrost-5-en-7-ylidene]amino}oxy)acetic acid |
| Synonyms | Source |
|---|---|
| dehydroepiandrosterone-7-carboxymethyloxime | ChEBI |
| DHEA-7-CMO | ChEBI |
| DHEA 7-O-(carboxymethyl)oxime | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2402395 | Reaxys |
| Citations |
|---|