EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N6O2 |
| Net Charge | -1 |
| Average Mass | 303.346 |
| Monoisotopic Mass | 303.15750 |
| SMILES | CC(C)=CCNc1ncn(CC[C@H](N)C(=O)[O-])c2ncnc1-2 |
| InChI | InChI=1S/C14H20N6O2/c1-9(2)3-5-16-12-11-13(18-7-17-11)20(8-19-12)6-4-10(15)14(21)22/h3,7-8,10,16H,4-6,15H2,1-2H3,(H,21,22)/p-1/t10-/m0/s1 |
| InChIKey | KGVAAXZLUAKZEO-JTQLQIEISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| discadenine(1−) (CHEBI:62934) is a L-α-amino acid anion (CHEBI:59814) |
| discadenine(1−) (CHEBI:62934) is conjugate base of discadenine (CHEBI:15955) |
| Incoming Relation(s) |
| discadenine (CHEBI:15955) is conjugate acid of discadenine(1−) (CHEBI:62934) |
| Synonym | Source |
|---|---|
| discadenine anion | ChEBI |