EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O |
| Net Charge | 0 |
| Average Mass | 86.134 |
| Monoisotopic Mass | 86.07316 |
| SMILES | C=C(C)CCO |
| InChI | InChI=1S/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| InChIKey | CPJRRXSHAYUTGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopentenyl alcohol (CHEBI:62898) has role metabolite (CHEBI:25212) |
| isopentenyl alcohol (CHEBI:62898) is a homoallylic alcohol (CHEBI:134362) |
| isopentenyl alcohol (CHEBI:62898) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| isopentenyl phosphate (CHEBI:65121) has functional parent isopentenyl alcohol (CHEBI:62898) |
| isopentenyl-UTP (CHEBI:62897) has functional parent isopentenyl alcohol (CHEBI:62898) |
| IUPAC Name |
|---|
| 3-methylbut-3-en-1-ol |
| Synonyms | Source |
|---|---|
| 3-Isopentenyl alcohol | ChemIDplus |
| Methallylcarbinol | ChemIDplus |
| 3-Methyl-3-buten-1-ol | ChemIDplus |
| Isopropenylethyl alcohol | ChemIDplus |
| Δ3-isopentenyl alcohol | ChEBI |
| Isoprenol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| US4220719 | Patent |
| US4205125 | Patent |
| KR20070114938 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1071239 | Reaxys |
| CAS:763-32-6 | ChemIDplus |