EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H19N3O3 |
| Net Charge | 0 |
| Average Mass | 409.445 |
| Monoisotopic Mass | 409.14264 |
| SMILES | [H][C@@]12C(=O)N(c3ccc(C(=O)Nc4cccc5cccnc45)cc3)C(=O)[C@]1([H])[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C25H19N3O3/c29-23(27-19-5-1-3-14-4-2-12-26-22(14)19)15-8-10-18(11-9-15)28-24(30)20-16-6-7-17(13-16)21(20)25(28)31/h1-12,16-17,20-21H,13H2,(H,27,29)/t16-,17+,20-,21+ |
| InChIKey | ZGSXEXBYLJIOGF-ALFLXDJESA-N |
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. axin stabilizer Any compound that stabilizes axin proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IWR-1-endo (CHEBI:62882) has role axin stabilizer (CHEBI:62914) |
| IWR-1-endo (CHEBI:62882) has role Wnt signalling inhibitor (CHEBI:78031) |
| IWR-1-endo (CHEBI:62882) is a benzamides (CHEBI:22702) |
| IWR-1-endo (CHEBI:62882) is a bridged compound (CHEBI:35990) |
| IWR-1-endo (CHEBI:62882) is a dicarboximide (CHEBI:35356) |
| IWR-1-endo (CHEBI:62882) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 4-[(3aR,4S,7R,7aS)-1,3-dioxo-1,3,3a,4,7,7a-hexahydro-2H-4,7-methanoisoindol-2-yl]-N-(quinolin-8-yl)benzamide |
| Synonym | Source |
|---|---|
| IRW1 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LSM-5707 | LINCS |
| WO2009155001 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19908763 | Reaxys |
| Citations |
|---|