EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N5O4 |
| Net Charge | 0 |
| Average Mass | 335.364 |
| Monoisotopic Mass | 335.15935 |
| SMILES | CC(C)=CCNc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21N5O4/c1-8(2)3-4-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(5-21)24-15/h3,6-7,9,11-12,15,21-23H,4-5H2,1-2H3,(H,16,17,18)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | USVMJSALORZVDV-SDBHATRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | DOI (10.1074/jbc.M314195200) |
| Roles Classification |
|---|
| Biological Roles: | plant growth regulator A chemical, natural or artificial, that can affect the rate of growth of a plant. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. cytokinin A phytohormone that promote cell division, or cytokinesis, in plant roots and shoots. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) has functional parent adenosine (CHEBI:16335) |
| N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) has role antineoplastic agent (CHEBI:35610) |
| N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) has role plant growth regulator (CHEBI:26155) |
| N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) has role plant metabolite (CHEBI:76924) |
| N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) is a N-ribosyl-N6-isopentenyladenine (CHEBI:26567) |
| N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) is a nucleoside analogue (CHEBI:60783) |
| Incoming Relation(s) |
| N6-(Δ2-isopentenyl)adenosine residue (CHEBI:62884) is substituent group from N6-(Δ2-isopentenyl)adenosine (CHEBI:62881) |
| IUPAC Name |
|---|
| N-(3-methylbut-2-en-1-yl)adenosine |
| INNs | Source |
|---|---|
| riboprina | ChemIDplus |
| riboprine | ChemIDplus |
| riboprinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-IPA | ChemIDplus |
| 2iPA | ChemIDplus |
| 6-(3-Methyl-2-butenylamino)purine riboside | ChemIDplus |
| 6-(γ,γ-dimethylallylamino)purine riboside | ChemIDplus |
| N-(3-methylbut-2-enyl)adenosine | ChemIDplus |
| N6-(2-isopentenyl)adenosine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| N6-(dimethylallyl)adenosine | UniProt |
| Citations |
|---|