EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H11F3N2OS |
| Net Charge | 0 |
| Average Mass | 312.316 |
| Monoisotopic Mass | 312.05442 |
| SMILES | Oc1nc(-c2ccc(C(F)(F)F)cc2)nc2c1CSCC2 |
| InChI | InChI=1S/C14H11F3N2OS/c15-14(16,17)9-3-1-8(2-4-9)12-18-11-5-6-21-7-10(11)13(20)19-12/h1-4H,5-7H2,(H,18,19,20) |
| InChIKey | KLGQSVMIPOVQAX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tankyrase inhibitor Any compound that inhibits the action of tankyrase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| XAV939 (CHEBI:62878) has role tankyrase inhibitor (CHEBI:62887) |
| XAV939 (CHEBI:62878) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| XAV939 (CHEBI:62878) is a thiopyranopyrimidine (CHEBI:62886) |
| IUPAC Name |
|---|
| 2-(4-(trifluoromethyl)phenyl)-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-4-ol |
| Synonym | Source |
|---|---|
| 2-[4-(trifluoromethyl)phenyl]-7,8-dihydro-5H-thiino[4,3-d]pyrimidin-4-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| LSM-5303 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20421945 | Reaxys |
| Citations |
|---|