EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)C)C[C@H]1C(=C)C |
| InChI | InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1 |
| InChIKey | OPFTUNCRGUEPRZ-QLFBSQMISA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-β-elemene (CHEBI:62855) has role antineoplastic agent (CHEBI:35610) |
| (−)-β-elemene (CHEBI:62855) is a β-elemene (CHEBI:62854) |
| IUPAC Name |
|---|
| (1S,2S,4R)-1-ethenyl-1-methyl-2,4-di(prop-1-en-2-yl)cyclohexane |
| Synonyms | Source |
|---|---|
| (1S,2S,4R)-(−)-1-methyl-1-vinyl-2,4-diisopropenylcyclohexane | ChEBI |
| (1S,2S,4R)-1-methyl-2,4-di(prop-1-en-2-yl)-1-vinylcyclohexane | IUPAC |
| (1S,2S,4R)-2,4-diisopropenyl-1-methyl-1-vinylcyclohexane | ChemIDplus |
| 2,4-Diisopropenyl-1-methyl-1-vinylcyclohexane | NIST Chemistry WebBook |
| beta-Elemen | ChemIDplus |
| (-)-beta-Elemene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (1S,2S,4R)-β-elemene | UniProt |
| Citations |
|---|