EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | [H][C@@]12CCc3c(ccc(O)c3O)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C18H24O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,16,19-21H,2-3,5,7-9H2,1H3/t11-,12-,14+,16+,18+/m1/s1 |
| InChIKey | QOZFCKXEVSGWGS-ZHIYBZGJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-17β-estradiol (CHEBI:62845) has functional parent 17β-estradiol (CHEBI:16469) |
| 4-hydroxy-17β-estradiol (CHEBI:62845) has role metabolite (CHEBI:25212) |
| 4-hydroxy-17β-estradiol (CHEBI:62845) is a 4-hydroxy steroid (CHEBI:62846) |
| Incoming Relation(s) |
| 4-hydroxy-17β-estradiol 3-O-(β-D-glucuronide) (CHEBI:137911) has functional parent 4-hydroxy-17β-estradiol (CHEBI:62845) |
| 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide) (CHEBI:137917) has functional parent 4-hydroxy-17β-estradiol (CHEBI:62845) |
| IUPAC Name |
|---|
| estra-1,3,5(10)-triene-3,14,17β-triol |
| Synonyms | Source |
|---|---|
| 3,4,17beta-estriol | HMDB |
| 3,4,17beta-trihydroxy-1,3,5[10]-estratriene | HMDB |
| 4-hydroxyestradiol | LIPID MAPS |
| 4-Hydroxyestradiol-17beta | KEGG COMPOUND |
| 4OHE2 | HMDB |
| 4-OH-Estradiol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-17β-estradiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C14209 | KEGG COMPOUND |
| HMDB0005896 | HMDB |
| LMST02010028 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2219366 | Reaxys |
| CAS:5976-61-4 | ChemIDplus |
| Citations |
|---|