EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:62810 - cis-heme d hydroxychlorin γ-spirolactone methyl ester
| Formula | C35H34FeN4O5 |
| Net Charge | 0 |
| Average Mass | 646.525 |
| Monoisotopic Mass | 646.18786 |
| SMILES | C=CC1=C(C)C2=[N+]3C1=Cc1c(C)c(C=C)c4[n]1[Fe-2]31[n]3c(c(C)c(CCC(=O)OC)c3=CC3=[N+]1C(=C4)[C@](C)(O)[C@@]31CCC(=O)O1)=C2 |
| InChI | InChI=1S/C35H34N4O5.Fe/c1-8-21-18(3)24-14-25-20(5)23(10-11-32(40)43-7)29(38-25)17-31-35(13-12-33(41)44-35)34(6,42)30(39-31)16-28-22(9-2)19(4)26(37-28)15-27(21)36-24;/h8-9,14-17,42H,1-2,10-13H2,3-7H3;/q-2;+2/t34-,35+;/m0./s1 |
| InChIKey | HSOAODYTIXUNJD-PFHIRXQESA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) has functional parent cis-heme d hydroxychlorin γ-spirolactone (CHEBI:47459) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) has functional parent methanol (CHEBI:17790) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) is a azaspiro compound (CHEBI:35624) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) is a ferroheme (CHEBI:38573) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) is a metallochlorin (CHEBI:62804) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) is a methyl ester (CHEBI:25248) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) is a oxaspiro compound (CHEBI:37948) |
| cis-heme d hydroxychlorin γ-spirolactone methyl ester (CHEBI:62810) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| {methyl 3-[(2RS,5'SR)-9',14'-diethenyl-5'-hydroxy-5',10',15',19'-tetramethyl-5-oxo-4,5-dihydro-3H-spiro[furan-2,4'-[21,22,23,24]tetraazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa[1,3(24),6,8,10,12,14,16(22),17,19]decaen]-20'-yl-κ4N21',N22',N23',N24']propanoatato(2−)}iron |
| Citations |
|---|