EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H32FeN4O5 |
| Net Charge | 0 |
| Average Mass | 632.498 |
| Monoisotopic Mass | 632.17221 |
| SMILES | C=CC1=C(C)C2=[N+]3C1=Cc1c(C)c(C=C)c4[n]1[Fe-2]31[n]3c(c(C)c(CCC(=O)O)c3=CC3=[N+]1C(=C4)[C@](C)(O)[C@]31CCC(=O)O1)=C2 |
| InChI | InChI=1S/C34H33N4O5.Fe/c1-7-20-17(3)23-13-24-19(5)22(9-10-31(39)40)28(37-24)16-30-34(12-11-32(41)43-34)33(6,42)29(38-30)15-27-21(8-2)18(4)25(36-27)14-26(20)35-23;/h7-8,13-16,42H,1-2,9-12H2,3-6H3,(H2-,35,36,37,38,39,40);/q-1;+2/p-1/t33-,34-;/m0./s1 |
| InChIKey | HMYRFFHHXXPRDI-GFLYYBHISA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a azaspiro compound (CHEBI:35624) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a ferroheme (CHEBI:38573) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a metallochlorin (CHEBI:62804) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a monocarboxylic acid (CHEBI:25384) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a oxaspiro compound (CHEBI:37948) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a tertiary alcohol (CHEBI:26878) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is a γ-lactone (CHEBI:37581) |
| trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) is conjugate acid of trans-heme d hydroxychlorin γ-spirolactone(1−) (CHEBI:62809) |
| Incoming Relation(s) |
| trans-heme d hydroxychlorin γ-spirolactone(1−) (CHEBI:62809) is conjugate base of trans-heme d hydroxychlorin γ-spirolactone (CHEBI:62808) |
| IUPAC Name |
|---|
| {3-[(2SR,5'SR)-9',14'-diethenyl-5'-hydroxy-5',10',15',19'-tetramethyl-5-oxo-4,5-dihydro-3H-spiro[furan-2,4'-[21,22,23,24]tetraazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa[1,3(24),6,8,10,12,14,16(22),17,19]decaen]-20'-yl-κ4N21',N22',N23',N24']propanoato(2−)}iron |
| Synonym | Source |
|---|---|
| trans-haem d hydroxychlorin γ-spirolactone | ChEBI |
| Citations |
|---|