EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@]12CC=C(C)[C@]3([H])[C@@]1(C)CCCC(C)(C)[C@]23[H] |
| InChI | InChI=1S/C15H24/c1-10-6-7-11-13-12(10)15(11,4)9-5-8-14(13,2)3/h6,11-13H,5,7-9H2,1-4H3/t11-,12+,13-,15+/m1/s1 |
| InChIKey | HICYDYJTCDBHMZ-COMQUAJESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-α-longipinene (CHEBI:62752) has role metabolite (CHEBI:25212) |
| (+)-α-longipinene (CHEBI:62752) is a α-longipinene (CHEBI:62753) |
| (+)-α-longipinene (CHEBI:62752) is enantiomer of (−)-α-longipinene (CHEBI:62751) |
| Incoming Relation(s) |
| (−)-α-longipinene (CHEBI:62751) is enantiomer of (+)-α-longipinene (CHEBI:62752) |
| IUPAC Name |
|---|
| (1R,2S,7R,8R)-2,6,6,9-tetramethyltricyclo[5.4.0.02,8]undec-9-ene |
| Synonym | Source |
|---|---|
| α-longipinene | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-α-longipinene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5329979 | Reaxys |
| Citations |
|---|