EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N2O10S2 |
| Net Charge | -1 |
| Average Mass | 477.493 |
| Monoisotopic Mass | 477.06431 |
| SMILES | COc1cccc2ncc(CC(=NOS(=O)(=O)[O-])S[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C17H22N2O10S2/c1-27-10-4-2-3-9-13(10)8(6-18-9)5-12(19-29-31(24,25)26)30-17-16(23)15(22)14(21)11(7-20)28-17/h2-4,6,11,14-18,20-23H,5,7H2,1H3,(H,24,25,26)/p-1/t11-,14-,15+,16-,17+/m1/s1 |
| InChIKey | IIAGSABLXRZUSE-UFRBAHOGSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxyglucobrassicin(1−) (CHEBI:62725) is a indolylmethylglucosinolate (CHEBI:24796) |
| 4-methoxyglucobrassicin(1−) (CHEBI:62725) is conjugate base of 4-methoxyglucobrassicin (CHEBI:1890) |
| Incoming Relation(s) |
| 4-methoxyglucobrassicin (CHEBI:1890) is conjugate acid of 4-methoxyglucobrassicin(1−) (CHEBI:62725) |
| IUPAC Name |
|---|
| 1-S-[2-(4-methoxy-1H-indol-3-yl)-N-(sulfonatooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| 4-methoxyglucobrassicin anion | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08423 | KEGG COMPOUND |
| 4-METHOXY-3-INDOLYLMETHYL-GLUCOSINOLATE | MetaCyc |
| C00000128 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5466754 | Reaxys |
| CAS:83327-21-3 | KEGG COMPOUND |