EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O10S2 |
| Net Charge | -1 |
| Average Mass | 463.466 |
| Monoisotopic Mass | 463.04866 |
| SMILES | O=S(=O)([O-])ON=C(Cc1cnc2cccc(O)c12)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20N2O10S2/c19-6-10-13(21)14(22)15(23)16(27-10)29-11(18-28-30(24,25)26)4-7-5-17-8-2-1-3-9(20)12(7)8/h1-3,5,10,13-17,19-23H,4,6H2,(H,24,25,26)/p-1/t10-,13-,14+,15-,16+/m1/s1 |
| InChIKey | CSMYCLLHRFFFLG-IRHMCKRBSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyglucobrassicin(1−) (CHEBI:62724) is a indolylmethylglucosinolate (CHEBI:24796) |
| 4-hydroxyglucobrassicin(1−) (CHEBI:62724) is conjugate base of 4-hydroxyglucobrassicin (CHEBI:1865) |
| Incoming Relation(s) |
| 4-hydroxyglucobrassicin (CHEBI:1865) is conjugate acid of 4-hydroxyglucobrassicin(1−) (CHEBI:62724) |
| IUPAC Name |
|---|
| 1-S-[2-(4-hydroxy-1H-indol-3-yl)-N-(sulfonatooxy)ethanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 4-hydroxy-3-indolylmethyl-glucosinolate | MetaCyc |
| 4-hydroxyglucobrassicin anion | ChEBI |
| 4-hydroxyindol-3-ylmethylglucosinolate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4-HYDROXY-3-INDOLYLMETHYL-GLUCOSINOLATE | MetaCyc |
| C00000127 | KNApSAcK |
| C08422 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:83327-20-2 | KEGG COMPOUND |