EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O |
| Net Charge | 0 |
| Average Mass | 232.327 |
| Monoisotopic Mass | 232.15756 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C14H20N2O/c1-2-14(17)16(12-6-4-3-5-7-12)13-8-10-15-11-9-13/h3-7,13,15H,2,8-11H2,1H3 |
| InChIKey | PMCBDBWCQQBSRJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norfentanyl (CHEBI:62685) has role drug metabolite (CHEBI:49103) |
| norfentanyl (CHEBI:62685) has role opioid analgesic (CHEBI:35482) |
| norfentanyl (CHEBI:62685) is a anilide (CHEBI:13248) |
| norfentanyl (CHEBI:62685) is a monocarboxylic acid amide (CHEBI:29347) |
| norfentanyl (CHEBI:62685) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| N-phenyl-N-(piperidin-4-yl)propanamide |
| Synonyms | Source |
|---|---|
| 4-(N'-phenyl-N'-propionyl)aminopiperidine | ChEBI |
| 4-(N-propionylanilino)piperidine | ChEBI |
| N-phenyl-N-4-piperidinylpropanamide | ChEBI |
| N-phenyl-N-4-piperidinylpropionamide | ChEBI |
| N-phenyl-N-(piperidin-4-yl)propionamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061006 | HMDB |
| Norfentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:480031 | Reaxys |
| CAS:1609-66-1 | NIST Chemistry WebBook |
| Citations |
|---|