EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19N5O9S2 |
| Net Charge | 0 |
| Average Mass | 453.455 |
| Monoisotopic Mass | 453.06242 |
| SMILES | C[C@H](NS(=O)(=O)O)[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C13H19N5O9S2/c1-5(18-29(24,25)26)7(10(20)21)16-9(19)8(6-4-28-12(14)15-6)17-27-13(2,3)11(22)23/h4-5,7,18H,1-3H3,(H2,14,15)(H,16,19)(H,20,21)(H,22,23)(H,24,25,26)/b17-8-/t5-,7-/m0/s1 |
| InChIKey | IBLNMEMSULYOOK-VEHQQRBSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SQ 26,992 (CHEBI:62665) has role allergen (CHEBI:50904) |
| SQ 26,992 (CHEBI:62665) has role metabolite (CHEBI:25212) |
| SQ 26,992 (CHEBI:62665) is a 1,3-thiazoles (CHEBI:38418) |
| SQ 26,992 (CHEBI:62665) is a dicarboxylic acid (CHEBI:35692) |
| SQ 26,992 (CHEBI:62665) is a sulfamic acids (CHEBI:35719) |
| IUPAC Name |
|---|
| (2S,3S)-2-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-{[(2-carboxypropan-2-yl)oxy]imino}acetyl]amino}-3-(sulfoamino)butanoic acid |
| Synonym | Source |
|---|---|
| SQ 26992 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6165935 | Reaxys |
| CAS:87500-74-1 | ChemIDplus |
| Citations |
|---|