EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6AsNO5 |
| Net Charge | 0 |
| Average Mass | 247.038 |
| Monoisotopic Mass | 246.94619 |
| SMILES | O=[N+]([O-])c1ccc([As](=O)(O)O)cc1 |
| InChI | InChI=1S/C6H6AsNO5/c9-7(10,11)5-1-3-6(4-2-5)8(12)13/h1-4H,(H2,9,10,11) |
| InChIKey | FUUFQLXAIUOWML-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nitarsone (CHEBI:62629) has functional parent phenylarsonic acid (CHEBI:29851) |
| nitarsone (CHEBI:62629) has role agrochemical (CHEBI:33286) |
| nitarsone (CHEBI:62629) has role antiprotozoal drug (CHEBI:35820) |
| nitarsone (CHEBI:62629) is a C-nitro compound (CHEBI:35716) |
| nitarsone (CHEBI:62629) is a organoarsonic acid (CHEBI:22638) |
| IUPAC Name |
|---|
| (4-nitrophenyl)arsonic acid |
| INNs | Source |
|---|---|
| nitarson | ChemIDplus |
| nitarsone | ChemIDplus |
| nitarsonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-nitrobenzenearsonic acid | ChemIDplus |
| 4-nitrophenylarsonic acid | ChemIDplus |
| 4-O2C6H4AsO3H2 | ChEBI |
| p-nitrobenzenearsonic acid | ChemIDplus |
| (p-nitrophenyl)arsonic acid | ChEBI |
| p-nitrophenylarsonic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Histostat | KEGG DRUG |
| Citations |
|---|