EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N4O2 |
| Net Charge | 0 |
| Average Mass | 182.183 |
| Monoisotopic Mass | 182.08038 |
| SMILES | Nc1nccc(C[C@H](N)C(=O)O)n1 |
| InChI | InChI=1S/C7H10N4O2/c8-5(6(12)13)3-4-1-2-10-7(9)11-4/h1-2,5H,3,8H2,(H,12,13)(H2,9,10,11)/t5-/m0/s1 |
| InChIKey | LIRGSTWGMWYHBN-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Lathyrine (CHEBI:6259) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Synonyms | Source |
|---|---|
| Lathyrine | KEGG COMPOUND |
| L-Lathyrine | KEGG COMPOUND |