EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21O17P2 |
| Net Charge | -3 |
| Average Mass | 499.231 |
| Monoisotopic Mass | 499.02704 |
| SMILES | O=P([O-])([O-])O[C@H]1[C@@H](O)[C@@H](OP(=O)([O-])O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H24O17P2/c13-1-2(14)5(17)10(6(18)3(1)15)28-31(25,26)29-12-8(20)4(16)7(19)11(9(12)21)27-30(22,23)24/h1-21H,(H,25,26)(H2,22,23,24)/p-3/t1-,2-,3+,4-,5-,6-,7-,8+,9+,10-,11+,12-/m0/s1 |
| InChIKey | ZFRNHZNPYSOZBU-MCUIPIIISA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(1L-myo-inositol) 3,1'-phosphate 1-phosphate(3−) (CHEBI:62576) is a inositol phosphate oxoanion (CHEBI:76301) |
| bis(1L-myo-inositol) 3,1'-phosphate 1-phosphate(3−) (CHEBI:62576) is conjugate base of bis(1L-myo-inositol) 3,1'-phosphate 1-phosphate (CHEBI:62574) |
| Incoming Relation(s) |
| bis(1L-myo-inositol) 3,1'-phosphate 1-phosphate (CHEBI:62574) is conjugate acid of bis(1L-myo-inositol) 3,1'-phosphate 1-phosphate(3−) (CHEBI:62576) |
| IUPAC Name |
|---|
| (1R,2S,3R,4R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl (1S,2R,3S,4S,5R,6R)-2,3,4,6-tetrahydroxy-5-(phosphonatooxy)cyclohexyl phosphate |
| UniProt Name | Source |
|---|---|
| bis(1L-myo-inositol) 3,1'-phosphate 1-phosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12856 | MetaCyc |
| Citations |
|---|