EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6257 - L-isoprenaline
| Formula | C11H17NO3 |
| Net Charge | 0 |
| Average Mass | 211.261 |
| Monoisotopic Mass | 211.12084 |
| SMILES | CC(C)NC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3/t11-/m0/s1 |
| InChIKey | JWZZKOKVBUJMES-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-isoprenaline (CHEBI:6257) has role sympathomimetic agent (CHEBI:35524) |
| L-isoprenaline (CHEBI:6257) has role β-adrenergic agonist (CHEBI:35522) |
| L-isoprenaline (CHEBI:6257) is a catecholamine (CHEBI:33567) |
| L-isoprenaline (CHEBI:6257) is a phenylethanolamines (CHEBI:25990) |
| IUPAC Name |
|---|
| 4-[(1R)-1-hydroxy-2-(isopropylamino)ethyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| Levisoprenalina | ChemIDplus |
| Levisoprenalinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (-)-Isoprenaline | ChemIDplus |
| Isopropyl norepinephrine | ChemIDplus |
| (-)-Isoproterenol | ChemIDplus |
| Levisoprenaline | KEGG COMPOUND |
| l-Isoprenaline | ChemIDplus |
| L-Isoprenaline | KEGG COMPOUND |