EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15N3O2 |
| Net Charge | 0 |
| Average Mass | 173.216 |
| Monoisotopic Mass | 173.11643 |
| SMILES | N=C(N)CCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15N3O2/c8-5(7(11)12)3-1-2-4-6(9)10/h5H,1-4,8H2,(H3,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | SILQDLDAWPQMEL-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-indospicine (CHEBI:6253) has role hepatotoxic agent (CHEBI:50908) |
| L-indospicine (CHEBI:6253) has role plant metabolite (CHEBI:76924) |
| L-indospicine (CHEBI:6253) is a carboxamidine (CHEBI:35359) |
| L-indospicine (CHEBI:6253) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| (2S)-2,7-diamino-7-iminoheptanoic acid |
| Synonym | Source |
|---|---|
| Indospicine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5330230 | Reaxys |
| CAS:16377-00-7 | KEGG COMPOUND |
| CAS:16377-00-7 | ChemIDplus |
| Citations |
|---|