EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O2 |
| Net Charge | 0 |
| Average Mass | 200.237 |
| Monoisotopic Mass | 200.08373 |
| SMILES | OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C13H12O2/c14-10-11-5-4-8-13(9-11)15-12-6-2-1-3-7-12/h1-9,14H,10H2 |
| InChIKey | KGANAERDZBAECK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-phenoxyphenyl)methanol (CHEBI:62527) has role marine xenobiotic metabolite (CHEBI:83399) |
| (3-phenoxyphenyl)methanol (CHEBI:62527) is a aromatic ether (CHEBI:35618) |
| (3-phenoxyphenyl)methanol (CHEBI:62527) is a benzyl alcohols (CHEBI:22743) |
| IUPAC Name |
|---|
| (3-phenoxyphenyl)methanol |
| Synonyms | Source |
|---|---|
| 1-hydroxymethyl-3-phenoxybenzene | ChEBI |
| 3-(Hydroxymethyl)diphenyl ether | ChemIDplus |
| 3-PBOH | ChEBI |
| 3-Phenoxybenzenemethanol | ChemIDplus |
| 3-Phenoxybenzyl alcohol | ChemIDplus |
| 3-Phenoxybenzylalcohol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (3-phenoxyphenyl)methanol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:475312 | Reaxys |
| CAS:13826-35-2 | ChemIDplus |
| Citations |
|---|