EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20Cl2O3 |
| Net Charge | 0 |
| Average Mass | 391.294 |
| Monoisotopic Mass | 390.07895 |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | RLLPVAHGXHCWKJ-PKOBYXMFSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | scabicide An acaricide that kills mites of the genus Sarcoptes. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-trans-permethrin (CHEBI:62523) is a trans-permethrin (CHEBI:62521) |
| IUPAC Name |
|---|
| 3-phenoxybenzyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| Synonym | Source |
|---|---|
| 1S-trans-Permethrin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-trans-permethrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13112 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:54774-47-9 | ChemIDplus |
| Citations |
|---|