EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O2 |
| Net Charge | 0 |
| Average Mass | 272.348 |
| Monoisotopic Mass | 272.15248 |
| SMILES | CC(C)=CCc1cccc2c(C[C@H]([NH3+])C(=O)[O-])cnc12 |
| InChI | InChI=1S/C16H20N2O2/c1-10(2)6-7-11-4-3-5-13-12(9-18-15(11)13)8-14(17)16(19)20/h3-6,9,14,18H,7-8,17H2,1-2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | OLFAGKNOXHVNHG-AWEZNQCLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-(3-methylbut-2-enyl)-L-tryptophan zwitterion (CHEBI:62497) is a amino-acid zwitterion (CHEBI:35238) |
| 7-(3-methylbut-2-enyl)-L-tryptophan zwitterion (CHEBI:62497) is tautomer of 7-(3-methylbut-2-enyl)-L-tryptophan (CHEBI:59356) |
| Incoming Relation(s) |
| 7-(3-methylbut-2-enyl)-L-tryptophan (CHEBI:59356) is tautomer of 7-(3-methylbut-2-enyl)-L-tryptophan zwitterion (CHEBI:62497) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-3-[7-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]propanoate |
| UniProt Name | Source |
|---|---|
| 7-(3-methylbut-2-enyl)-L-tryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12156 | MetaCyc |