EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48NO7 |
| Net Charge | +1 |
| Average Mass | 462.648 |
| Monoisotopic Mass | 462.34253 |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@@H]([NH3+])COC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H47NO7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(27)18(25)17-31-24-23(30)22(29)21(28)20(16-26)32-24/h14-15,18-24,26-30H,2-13,16-17,25H2,1H3/p+1/b15-14+/t18-,19+,20+,21+,22-,23+,24?/m0/s1 |
| InChIKey | HHJTWTPUPVQKNA-WNCZHHJSSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-glucosylsphingosine(1+) (CHEBI:62495) is a ammonium ion derivative (CHEBI:35274) |
| D-glucosylsphingosine(1+) (CHEBI:62495) is conjugate acid of D-glucosylsphingosine (CHEBI:4177) |
| Incoming Relation(s) |
| β-D-glucosylsphingosine(1+) (CHEBI:83992) is a D-glucosylsphingosine(1+) (CHEBI:62495) |
| D-glucosylsphingosine (CHEBI:4177) is conjugate base of D-glucosylsphingosine(1+) (CHEBI:62495) |
| IUPAC Name |
|---|
| (2S,3R,4E)-1-(D-glucopyranosyloxy)-3-hydroxyoctadec-4-en-2-aminium |
| Citations |
|---|