EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O |
| Net Charge | 0 |
| Average Mass | 426.729 |
| Monoisotopic Mass | 426.38617 |
| SMILES | [H][C@@]12CC[C@@]3([H])/C(=C(/C)CCC=C(C)C)CC[C@]3(C)[C@@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-29(7)23(22)12-13-25-28(6)17-16-26(31)27(4,5)24(28)15-19-30(25,29)8/h10,23-26,31H,9,11-19H2,1-8H3/b22-21-/t23-,24-,25-,26-,28-,29-,30-/m0/s1 |
| InChIKey | CKYVHRSYUPJCLG-PTZNGALWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (17Z)-protosta-17(20),24-dien-3β-ol (CHEBI:62457) has parent hydride protostane (CHEBI:36483) |
| (17Z)-protosta-17(20),24-dien-3β-ol (CHEBI:62457) has role metabolite (CHEBI:25212) |
| (17Z)-protosta-17(20),24-dien-3β-ol (CHEBI:62457) is a 3β-hydroxy steroid (CHEBI:36836) |
| (17Z)-protosta-17(20),24-dien-3β-ol (CHEBI:62457) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| (17Z)-protosta-17(20),24-dien-3β-ol (CHEBI:62457) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Names |
|---|
| (17Z)-ent-10α-dammara-17,24-dien-3α-ol |
| (3β,8α,9β,13α,14β,17Z)-dammara-17,24-dien-3β-ol |
| Synonyms | Source |
|---|---|
| (17Z)-protosta-17(20),24-dien-3β-ol | ChEBI |
| protostadienol | ChEBI |
| protosta-17(20)Z,24-dien-3β-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| (17Z)-protosta-17(20),24-dien-3β-ol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2545048 | Reaxys |
| Citations |
|---|