EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56O9 |
| Net Charge | 0 |
| Average Mass | 632.835 |
| Monoisotopic Mass | 632.39243 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC(=O)[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@H](O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@]1(C)CO |
| InChI | InChI=1S/C36H56O9/c1-31(2)16-20-19-8-9-22-33(4)12-11-24(44-30-27(41)25(39)26(40)28(45-30)29(42)43)34(5,18-37)21(33)10-13-36(22,7)35(19,6)15-14-32(20,3)23(38)17-31/h8,20-22,24-28,30,37,39-41H,9-18H2,1-7H3,(H,42,43)/t20-,21+,22+,24-,25-,26-,27+,28-,30+,32+,33-,34+,35+,36+/m0/s1 |
| InChIKey | CBJRVPYJFXDQDY-YHYIZMBSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soyasapogenol E 3-O-β-glucuronide (CHEBI:62445) has functional parent soyasapogenol E (CHEBI:62444) |
| soyasapogenol E 3-O-β-glucuronide (CHEBI:62445) is a triterpenoid saponin (CHEBI:61778) |
| soyasapogenol E 3-O-β-glucuronide (CHEBI:62445) is a β-D-glucosiduronic acid (CHEBI:15341) |
| soyasapogenol E 3-O-β-glucuronide (CHEBI:62445) is conjugate acid of soyasapogenol E 3-O-β-glucuronate (CHEBI:62446) |
| Incoming Relation(s) |
| soyasapogenol E 3-O-β-glucuronate (CHEBI:62446) is conjugate base of soyasapogenol E 3-O-β-glucuronide (CHEBI:62445) |
| IUPAC Name |
|---|
| (3β)-24-hydroxy-22-oxoolean-12-en-3-yl gluco-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| soyasapogenol E-3-O-glucuronide | ChEBI |
| soyasapogenol E-3-O-β-glucuronide | ChEBI |
| soyasapogenol E monoglucuronide | ChEBI |
| Citations |
|---|