EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19O4 |
| Net Charge | -1 |
| Average Mass | 263.313 |
| Monoisotopic Mass | 263.12888 |
| SMILES | CC1=CC(=O)CC(C)(C)[C@]1(O)/C=C/C(C)=C/C(=O)[O-] |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/p-1/b6-5+,10-7+/t15-/m0/s1 |
| InChIKey | JLIDBLDQVAYHNE-XQFZKXHBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-trans-abscisate (CHEBI:62433) is a 2-trans-abscisate (CHEBI:62429) |
| (R)-2-trans-abscisate (CHEBI:62433) is conjugate base of (R)-2-trans-abscisic acid (CHEBI:18657) |
| (R)-2-trans-abscisate (CHEBI:62433) is enantiomer of (S)-2-trans-abscisate (CHEBI:62421) |
| Incoming Relation(s) |
| (R)-2-trans-abscisic acid (CHEBI:18657) is conjugate acid of (R)-2-trans-abscisate (CHEBI:62433) |
| (S)-2-trans-abscisate (CHEBI:62421) is enantiomer of (R)-2-trans-abscisate (CHEBI:62433) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1R)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoate |