EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H75N5O8 |
| Net Charge | 0 |
| Average Mass | 838.144 |
| Monoisotopic Mass | 837.56156 |
| SMILES | CCCCCCCCCCCCCCCCC/C=C\C(=O)NCCCCC(NC(=O)C1(C)COC(c2ccccc2O)=N1)C(=O)OC(C)CC(=O)NC1CCCCNC1=O |
| InChI | InChI=1S/C47H75N5O8/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-31-41(54)48-32-25-24-29-39(45(57)60-36(2)34-42(55)50-38-28-23-26-33-49-43(38)56)51-46(58)47(3)35-59-44(52-47)37-27-21-22-30-40(37)53/h20-22,27,30-31,36,38-39,53H,4-19,23-26,28-29,32-35H2,1-3H3,(H,48,54)(H,49,56)(H,50,55)(H,51,58)/b31-20- |
| InChIKey | JLBSVDZUWJLOCF-GTWSWNCMSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DDM-838 (CHEBI:62384) has role antigen (CHEBI:59132) |
| DDM-838 (CHEBI:62384) is a 1,3-oxazoles (CHEBI:46812) |
| DDM-838 (CHEBI:62384) is a carboxylic ester (CHEBI:33308) |
| DDM-838 (CHEBI:62384) is a lactam (CHEBI:24995) |
| DDM-838 (CHEBI:62384) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 4-oxo-4-[(2-oxoazepan-3-yl)amino]butan-2-yl N2-{[2-(2-hydroxyphenyl)-4-methyl-4,5-dihydro-1,3-oxazol-4-yl]carbonyl}-N6-[(2Z)-icos-2-enoyl]lysinate |
| Synonyms | Source |
|---|---|
| didehydroxymycobactin-838 | ChEBI |
| DDM 838 | ChEBI |
| didehydroxymycobactin 838 | ChEBI |
| dideoxymycobactin | ChEBI |
| DDM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA00000015 | LIPID MAPS |
| Citations |
|---|